About (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal
(E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal (PubChem CID 118656995) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal.
Molecular Properties
| Compound Name | (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal |
| PubChem CID | 118656995 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal |
| SMILES | C/C(C=O)=C\CC1OCC(N)CO1 |
| InChI | InChI=1S/C9H15NO3/c1-7(4-11)2-3-9-12-5-8(10)6-13-9/h2,4,8-9H,3,5-6,10H2,1H3/b7-2+ |
| InChIKey | ZOILZNIBCOHCIC-FARCUNLSSA-N |
| XLogP | 0.22 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal?
The IUPAC name of (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal (CID 118656995) is (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal.
What is the SMILES notation for (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal?
The canonical SMILES for (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal is C/C(C=O)=C\CC1OCC(N)CO1.
What is the InChIKey of (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal?
The InChIKey is ZOILZNIBCOHCIC-FARCUNLSSA-N. The full InChI is InChI=1S/C9H15NO3/c1-7(4-11)2-3-9-12-5-8(10)6-13-9/h2,4,8-9H,3,5-6,10H2,1H3/b7-2+.
What are the key properties of (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal?
(E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal has a molecular weight of 185.22 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(5-amino-1,3-dioxan-2-yl)-2-methylbut-2-enal is sourced from PubChem (CID 118656995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).