C36H35FN4O4 — CID 118657313
3-[[4-[2-amino-5-(3,4-dihydroxyphenyl)-3-pyridinyl]-3-fluoroanilino]methyl]-5-(4-methylphenyl)-1-(oxan-4-ylmethyl)pyridin-4-one (PubChem CID 118657313) has the molecular formula C36H35FN4O4 and a molecular weight of 606.70 g/mol. Its IUPAC name is 3-[[4-[2-amino-5-(3,4-dihydroxyphenyl)-3-pyridinyl]-3-fluoroanilino]methyl]-5-(4-methylphenyl)-1-(oxan-4-ylmethyl)pyridin-4-one.
| Compound Name | 3-[[4-[2-amino-5-(3,4-dihydroxyphenyl)-3-pyridinyl]-3-fluoroanilino]methyl]-5-(4-methylphenyl)-1-(oxan-4-ylmethyl)pyridin-4-one |
|---|---|
| PubChem CID | 118657313 |
| Molecular Formula | C36H35FN4O4 |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 3-[[4-[2-amino-5-(3,4-dihydroxyphenyl)-3-pyridinyl]-3-fluoroanilino]methyl]-5-(4-methylphenyl)-1-(oxan-4-ylmethyl)pyridin-4-one |
| SMILES | Cc1ccc(-c2cn(CC3CCOCC3)cc(CNc3ccc(-c4cc(-c5ccc(O)c(O)c5)cnc4N)c(F)c3)c2=O)cc1 |
| InChI | InChI=1S/C36H35FN4O4/c1-22-2-4-24(5-3-22)31-21-41(19-23-10-12-45-13-11-23)20-27(35(31)44)18-39-28-7-8-29(32(37)16-28)30-14-26(17-40-36(30)38)25-6-9-33(42)34(43)15-25/h2-9,14-17,20-21,23,39,42-43H,10-13,18-19H2,1H3,(H2,38,40) |
| InChIKey | SIIVOJMHPKEMHQ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|