C17H24O5 — CID 118657499
(4E,9E)-12-[(Z)-but-2-en-2-yl]-7,8-dihydroxy-3,9-dimethyl-1-oxacyclododeca-4,9-diene-2,6-dione (PubChem CID 118657499) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (4E,9E)-12-[(Z)-but-2-en-2-yl]-7,8-dihydroxy-3,9-dimethyl-1-oxacyclododeca-4,9-diene-2,6-dione.
| Compound Name | (4E,9E)-12-[(Z)-but-2-en-2-yl]-7,8-dihydroxy-3,9-dimethyl-1-oxacyclododeca-4,9-diene-2,6-dione |
|---|---|
| PubChem CID | 118657499 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (4E,9E)-12-[(Z)-but-2-en-2-yl]-7,8-dihydroxy-3,9-dimethyl-1-oxacyclododeca-4,9-diene-2,6-dione |
| SMILES | C/C=C(/C)C1C/C=C(\C)C(O)C(O)C(=O)/C=C/C(C)C(=O)O1 |
| InChI | InChI=1S/C17H24O5/c1-5-10(2)14-9-7-11(3)15(19)16(20)13(18)8-6-12(4)17(21)22-14/h5-8,12,14-16,19-20H,9H2,1-4H3/b8-6+,10-5-,11-7+ |
| InChIKey | PCTHVEXGBNLGKT-QUZZBHBQSA-N |
| XLogP | 1.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|