C17H28N4O3 — CID 11865770
1-[(3R,8S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]-3-cyclohexylurea (PubChem CID 11865770) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[(3R,8S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]-3-cyclohexylurea.
| Compound Name | 1-[(3R,8S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 11865770 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[(3R,8S,8aS)-1,4-dioxo-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]-3-cyclohexylurea |
| SMILES | CC(C)[C@H]1NC(=O)[C@@H]2[C@@H](NC(=O)NC3CCCCC3)CCN2C1=O |
| InChI | InChI=1S/C17H28N4O3/c1-10(2)13-16(23)21-9-8-12(14(21)15(22)20-13)19-17(24)18-11-6-4-3-5-7-11/h10-14H,3-9H2,1-2H3,(H,20,22)(H2,18,19,24)/t12-,13+,14-/m0/s1 |
| InChIKey | KURZQBKKLUVFHC-MJBXVCDLSA-N |
| XLogP | 0.74 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |