C17H27N5O4 — CID 11865821
(2S,3S)-N-(2-amino-2-oxoethyl)-N-methyl-1-(3-methylbut-2-enoyl)-3-(prop-2-enylcarbamoylamino)pyrrolidine-2-carboxamide (PubChem CID 11865821) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2S,3S)-N-(2-amino-2-oxoethyl)-N-methyl-1-(3-methylbut-2-enoyl)-3-(prop-2-enylcarbamoylamino)pyrrolidine-2-carboxamide.
| Compound Name | (2S,3S)-N-(2-amino-2-oxoethyl)-N-methyl-1-(3-methylbut-2-enoyl)-3-(prop-2-enylcarbamoylamino)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11865821 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (2S,3S)-N-(2-amino-2-oxoethyl)-N-methyl-1-(3-methylbut-2-enoyl)-3-(prop-2-enylcarbamoylamino)pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)N[C@H]1CCN(C(=O)C=C(C)C)[C@@H]1C(=O)N(C)CC(N)=O |
| InChI | InChI=1S/C17H27N5O4/c1-5-7-19-17(26)20-12-6-8-22(14(24)9-11(2)3)15(12)16(25)21(4)10-13(18)23/h5,9,12,15H,1,6-8,10H2,2-4H3,(H2,18,23)(H2,19,20,26)/t12-,15-/m0/s1 |
| InChIKey | OYVNRQCLQYRVMK-WFASDCNBSA-N |
| XLogP | -0.65 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|