About (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate
(4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate (PubChem CID 118659155) has the molecular formula C18H14N6O2S2
and a molecular weight of 410.48 g/mol. Its IUPAC name is (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate.
Molecular Properties
| Compound Name | (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate |
| PubChem CID | 118659155 |
| Molecular Formula | C18H14N6O2S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate |
| SMILES | Cc1ccc(-c2cncs2)cc1-c1cnc(NC(=O)Oc2snnc2C)cn1 |
| InChI | InChI=1S/C18H14N6O2S2/c1-10-3-4-12(15-7-19-9-27-15)5-13(10)14-6-21-16(8-20-14)22-18(25)26-17-11(2)23-24-28-17/h3-9H,1-2H3,(H,21,22,25) |
| InChIKey | YYMCWOAYWZNGCS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate?
The IUPAC name of (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate (CID 118659155) is (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate.
What is the SMILES notation for (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate?
The canonical SMILES for (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate is Cc1ccc(-c2cncs2)cc1-c1cnc(NC(=O)Oc2snnc2C)cn1.
What is the InChIKey of (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate?
The InChIKey is YYMCWOAYWZNGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N6O2S2/c1-10-3-4-12(15-7-19-9-27-15)5-13(10)14-6-21-16(8-20-14)22-18(25)26-17-11(2)23-24-28-17/h3-9H,1-2H3,(H,21,22,25).
What are the key properties of (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate?
(4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate has a molecular weight of 410.48 g/mol, XLogP of 4.35, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylthiadiazol-5-yl) N-[5-[2-methyl-5-(1,3-thiazol-5-yl)phenyl]pyrazin-2-yl]carbamate is sourced from PubChem (CID 118659155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).