C18H25NO14 — CID 118659162
2-(carboxymethylamino)-2-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyacetic acid (PubChem CID 118659162) has the molecular formula C18H25NO14 and a molecular weight of 479.39 g/mol. Its IUPAC name is 2-(carboxymethylamino)-2-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyacetic acid.
| Compound Name | 2-(carboxymethylamino)-2-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 118659162 |
| Molecular Formula | C18H25NO14 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-(carboxymethylamino)-2-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyacetic acid |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(NCC(=O)O)C(=O)O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H25NO14/c1-7(20)28-6-11-13(29-8(2)21)14(30-9(3)22)15(31-10(4)23)18(32-11)33-16(17(26)27)19-5-12(24)25/h11,13-16,18-19H,5-6H2,1-4H3,(H,24,25)(H,26,27)/t11-,13-,14-,15+,16?,18-/m1/s1 |
| InChIKey | KSLOQASZANBIQT-OLIZGOSISA-N |
| XLogP | -1.83 |
| TPSA | 210.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|