C6H13F6N2O4S2+ — CID 118659642
N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride;tetramethylazanium (PubChem CID 118659642) has the molecular formula C6H13F6N2O4S2+ and a molecular weight of 355.30 g/mol. Its IUPAC name is N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride;tetramethylazanium.
| Compound Name | N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride;tetramethylazanium |
|---|---|
| PubChem CID | 118659642 |
| Molecular Formula | C6H13F6N2O4S2+ |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride;tetramethylazanium |
| SMILES | C[N+](C)(C)C.O=S(=O)(F)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H12N.C2HF6NO4S2/c1-5(2,3)4;3-1(4,5)2(6,7)14(10,11)9-15(8,12)13/h1-4H3;9H/q+1; |
| InChIKey | GJOMKDPHWAJGSO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|