About N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride
N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride (PubChem CID 118659645) has the molecular formula C4H10F4N2O4S2
and a molecular weight of 290.26 g/mol. Its IUPAC name is N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride |
| PubChem CID | 118659645 |
| Molecular Formula | C4H10F4N2O4S2 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride |
| SMILES | CN(C)C.O=S(=O)(F)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C3H9N.CHF4NO4S2/c1-4(2)3;2-1(3,4)11(7,8)6-12(5,9)10/h1-3H3;6H |
| InChIKey | PKQFNSYKKJOEFT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride?
The IUPAC name of N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride (CID 118659645) is N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride.
What is the SMILES notation for N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride?
The canonical SMILES for N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride is CN(C)C.O=S(=O)(F)NS(=O)(=O)C(F)(F)F.
What is the InChIKey of N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride?
The InChIKey is PKQFNSYKKJOEFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.CHF4NO4S2/c1-4(2)3;2-1(3,4)11(7,8)6-12(5,9)10/h1-3H3;6H.
What are the key properties of N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride?
N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride has a molecular weight of 290.26 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride is sourced from PubChem (CID 118659645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).