C9H17F6N2O4S2+ — CID 118659648
1-ethyl-1-methylpyrrolidin-1-ium;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride (PubChem CID 118659648) has the molecular formula C9H17F6N2O4S2+ and a molecular weight of 395.37 g/mol. Its IUPAC name is 1-ethyl-1-methylpyrrolidin-1-ium;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride.
| Compound Name | 1-ethyl-1-methylpyrrolidin-1-ium;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride |
|---|---|
| PubChem CID | 118659648 |
| Molecular Formula | C9H17F6N2O4S2+ |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 1-ethyl-1-methylpyrrolidin-1-ium;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride |
| SMILES | CC[N+]1(C)CCCC1.O=S(=O)(F)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H16N.C2HF6NO4S2/c1-3-8(2)6-4-5-7-8;3-1(4,5)2(6,7)14(10,11)9-15(8,12)13/h3-7H2,1-2H3;9H/q+1; |
| InChIKey | GYQXXIIUCWZBLX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|