C6H12F6N2O4S2 — CID 118659653
N-ethylethanamine;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride (PubChem CID 118659653) has the molecular formula C6H12F6N2O4S2 and a molecular weight of 354.29 g/mol. Its IUPAC name is N-ethylethanamine;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride.
| Compound Name | N-ethylethanamine;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride |
|---|---|
| PubChem CID | 118659653 |
| Molecular Formula | C6H12F6N2O4S2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-ethylethanamine;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride |
| SMILES | CCNCC.O=S(=O)(F)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H11N.C2HF6NO4S2/c1-3-5-4-2;3-1(4,5)2(6,7)14(10,11)9-15(8,12)13/h5H,3-4H2,1-2H3;9H |
| InChIKey | LNIPUHPZCCCMHC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|