About tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride
tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride (PubChem CID 118659677) has the molecular formula C5H13F4N2O4S2+
and a molecular weight of 305.30 g/mol. Its IUPAC name is tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride.
Molecular Properties
| Compound Name | tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride |
| PubChem CID | 118659677 |
| Molecular Formula | C5H13F4N2O4S2+ |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride |
| SMILES | C[N+](C)(C)C.O=S(=O)(F)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H12N.CHF4NO4S2/c1-5(2,3)4;2-1(3,4)11(7,8)6-12(5,9)10/h1-4H3;6H/q+1; |
| InChIKey | MPVFMTIODJMLRU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride?
The IUPAC name of tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride (CID 118659677) is tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride.
What is the SMILES notation for tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride?
The canonical SMILES for tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride is C[N+](C)(C)C.O=S(=O)(F)NS(=O)(=O)C(F)(F)F.
What is the InChIKey of tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride?
The InChIKey is MPVFMTIODJMLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N.CHF4NO4S2/c1-5(2,3)4;2-1(3,4)11(7,8)6-12(5,9)10/h1-4H3;6H/q+1;.
What are the key properties of tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride?
tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride has a molecular weight of 305.30 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetramethylazanium;N-(trifluoromethylsulfonyl)sulfamoyl fluoride is sourced from PubChem (CID 118659677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).