C21H21ClN2O3S — CID 11866022
(6aR,7S)-2-(5-chloro-2-methoxyphenyl)-7-ethylsulfanyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 11866022) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is (6aR,7S)-2-(5-chloro-2-methoxyphenyl)-7-ethylsulfanyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aR,7S)-2-(5-chloro-2-methoxyphenyl)-7-ethylsulfanyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 11866022 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (6aR,7S)-2-(5-chloro-2-methoxyphenyl)-7-ethylsulfanyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | CCS[C@H]1CCN2C(=O)c3cc(-c4cc(Cl)ccc4OC)ccc3NC(=O)[C@H]12 |
| InChI | InChI=1S/C21H21ClN2O3S/c1-3-28-18-8-9-24-19(18)20(25)23-16-6-4-12(10-15(16)21(24)26)14-11-13(22)5-7-17(14)27-2/h4-7,10-11,18-19H,3,8-9H2,1-2H3,(H,23,25)/t18-,19-/m0/s1 |
| InChIKey | WELGBWZFFXIPFI-OALUTQOASA-N |
| XLogP | 4.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |