About 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine
2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine (PubChem CID 118660757) has the molecular formula C22H21N5O
and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine.
Molecular Properties
| Compound Name | 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine |
| PubChem CID | 118660757 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine |
| SMILES | COC1CN(c2ccc3cncc(-c4ccc(-c5cnn(C)c5)cc4)c3n2)C1 |
| InChI | InChI=1S/C22H21N5O/c1-26-12-18(10-24-26)15-3-5-16(6-4-15)20-11-23-9-17-7-8-21(25-22(17)20)27-13-19(14-27)28-2/h3-12,19H,13-14H2,1-2H3 |
| InChIKey | SLMBTUSZZKPYMQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine?
The IUPAC name of 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine (CID 118660757) is 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine.
What is the SMILES notation for 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine?
The canonical SMILES for 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine is COC1CN(c2ccc3cncc(-c4ccc(-c5cnn(C)c5)cc4)c3n2)C1.
What is the InChIKey of 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine?
The InChIKey is SLMBTUSZZKPYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5O/c1-26-12-18(10-24-26)15-3-5-16(6-4-15)20-11-23-9-17-7-8-21(25-22(17)20)27-13-19(14-27)28-2/h3-12,19H,13-14H2,1-2H3.
What are the key properties of 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine?
2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine has a molecular weight of 371.44 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyazetidin-1-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine is sourced from PubChem (CID 118660757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).