C13H20N4O3S — CID 11866092
N-[(3S,4S,9S,11S)-11-amino-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]-2-methylsulfanylacetamide (PubChem CID 11866092) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is N-[(3S,4S,9S,11S)-11-amino-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]-2-methylsulfanylacetamide.
| Compound Name | N-[(3S,4S,9S,11S)-11-amino-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 11866092 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[(3S,4S,9S,11S)-11-amino-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)N[C@H]1CCN2C(=O)[C@@H]3C[C@H](N)CN3C(=O)[C@H]12 |
| InChI | InChI=1S/C13H20N4O3S/c1-21-6-10(18)15-8-2-3-16-11(8)13(20)17-5-7(14)4-9(17)12(16)19/h7-9,11H,2-6,14H2,1H3,(H,15,18)/t7-,8-,9-,11-/m0/s1 |
| InChIKey | RXBGIFSGQMVRRY-KBIXCLLPSA-N |
| XLogP | -1.62 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |