About (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine
(S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine (PubChem CID 118661076) has the molecular formula C16H10F7N3
and a molecular weight of 377.26 g/mol. Its IUPAC name is (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine.
Molecular Properties
| Compound Name | (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine |
| PubChem CID | 118661076 |
| Molecular Formula | C16H10F7N3 |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine |
| SMILES | N[C@@H](c1ccc(F)cc1)c1nc2c(C(F)(F)F)cc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C16H10F7N3/c17-9-3-1-7(2-4-9)12(24)14-25-11-6-8(15(18,19)20)5-10(13(11)26-14)16(21,22)23/h1-6,12H,24H2,(H,25,26)/t12-/m0/s1 |
| InChIKey | SHZNMCGCUCVMSX-LBPRGKRZSA-N |
| XLogP | 4.79 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine?
The IUPAC name of (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine (CID 118661076) is (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine.
What is the SMILES notation for (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine?
The canonical SMILES for (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine is N[C@@H](c1ccc(F)cc1)c1nc2c(C(F)(F)F)cc(C(F)(F)F)cc2[nH]1.
What is the InChIKey of (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine?
The InChIKey is SHZNMCGCUCVMSX-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H10F7N3/c17-9-3-1-7(2-4-9)12(24)14-25-11-6-8(15(18,19)20)5-10(13(11)26-14)16(21,22)23/h1-6,12H,24H2,(H,25,26)/t12-/m0/s1.
What are the key properties of (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine?
(S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine has a molecular weight of 377.26 g/mol, XLogP of 4.79, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-[4,6-bis(trifluoromethyl)-1H-benzimidazol-2-yl]-(4-fluorophenyl)methanamine is sourced from PubChem (CID 118661076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).