C19H26N3O7- — CID 11866161
2-[2-[[(3S,5R,9S,11S)-5-(cyclopropylmethoxy)-2,8-dioxo-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl]amino]-2-oxoethoxy]acetate (PubChem CID 11866161) has the molecular formula C19H26N3O7- and a molecular weight of 408.43 g/mol. Its IUPAC name is 2-[2-[[(3S,5R,9S,11S)-5-(cyclopropylmethoxy)-2,8-dioxo-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl]amino]-2-oxoethoxy]acetate.
| Compound Name | 2-[2-[[(3S,5R,9S,11S)-5-(cyclopropylmethoxy)-2,8-dioxo-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl]amino]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 11866161 |
| Molecular Formula | C19H26N3O7- |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[2-[[(3S,5R,9S,11S)-5-(cyclopropylmethoxy)-2,8-dioxo-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl]amino]-2-oxoethoxy]acetate |
| SMILES | O=C([O-])COCC(=O)N[C@H]1CCN2C(=O)[C@@H]3C[C@@H](OCC4CC4)CN3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C19H27N3O7/c23-16(9-28-10-17(24)25)20-12-3-4-21-14(5-12)19(27)22-7-13(6-15(22)18(21)26)29-8-11-1-2-11/h11-15H,1-10H2,(H,20,23)(H,24,25)/p-1/t12-,13+,14-,15-/m0/s1 |
| InChIKey | AMRDVQXDLSPJTO-XGUBFFRZSA-M |
| XLogP | -2.36 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |