About tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate
tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate (PubChem CID 118661791) has the molecular formula C11H20FNO2S
and a molecular weight of 249.35 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate |
| PubChem CID | 118661791 |
| Molecular Formula | C11H20FNO2S |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate |
| SMILES | CS[C@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C11H20FNO2S/c1-11(2,3)15-10(14)13-6-5-9(16-4)8(12)7-13/h8-9H,5-7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | QMDRKTNKLJTMHQ-IUCAKERBSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate?
The IUPAC name of tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate (CID 118661791) is tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate is CS[C@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]1F.
What is the InChIKey of tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate?
The InChIKey is QMDRKTNKLJTMHQ-IUCAKERBSA-N. The full InChI is InChI=1S/C11H20FNO2S/c1-11(2,3)15-10(14)13-6-5-9(16-4)8(12)7-13/h8-9H,5-7H2,1-4H3/t8-,9-/m0/s1.
What are the key properties of tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate?
tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate has a molecular weight of 249.35 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S,4S)-3-fluoro-4-methylsulfanylpiperidine-1-carboxylate is sourced from PubChem (CID 118661791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).