About N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide
N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide (PubChem CID 118662941) has the molecular formula C19H17F2N3O3
and a molecular weight of 373.36 g/mol. Its IUPAC name is N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide.
Molecular Properties
| Compound Name | N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide |
| PubChem CID | 118662941 |
| Molecular Formula | C19H17F2N3O3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide |
| SMILES | COc1cc(C(=O)N[C@H](CO)c2c(F)cccc2F)ccc1-c1cn[nH]c1 |
| InChI | InChI=1S/C19H17F2N3O3/c1-27-17-7-11(5-6-13(17)12-8-22-23-9-12)19(26)24-16(10-25)18-14(20)3-2-4-15(18)21/h2-9,16,25H,10H2,1H3,(H,22,23)(H,24,26)/t16-/m1/s1 |
| InChIKey | VUKPYAYVXNDTIK-MRXNPFEDSA-N |
| XLogP | 2.83 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide?
The IUPAC name of N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide (CID 118662941) is N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide.
What is the SMILES notation for N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide?
The canonical SMILES for N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide is COc1cc(C(=O)N[C@H](CO)c2c(F)cccc2F)ccc1-c1cn[nH]c1.
What is the InChIKey of N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide?
The InChIKey is VUKPYAYVXNDTIK-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H17F2N3O3/c1-27-17-7-11(5-6-13(17)12-8-22-23-9-12)19(26)24-16(10-25)18-14(20)3-2-4-15(18)21/h2-9,16,25H,10H2,1H3,(H,22,23)(H,24,26)/t16-/m1/s1.
What are the key properties of N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide?
N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide has a molecular weight of 373.36 g/mol, XLogP of 2.83, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(2,6-difluorophenyl)-2-hydroxyethyl]-3-methoxy-4-(1H-pyrazol-4-yl)benzamide is sourced from PubChem (CID 118662941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).