C19H17F2N3O2 — CID 118663029
N-[1-(2,6-difluorophenyl)ethyl]-2-methoxy-4-(1H-pyrazol-4-yl)benzamide (PubChem CID 118663029) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethyl]-2-methoxy-4-(1H-pyrazol-4-yl)benzamide.
| Compound Name | N-[1-(2,6-difluorophenyl)ethyl]-2-methoxy-4-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 118663029 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethyl]-2-methoxy-4-(1H-pyrazol-4-yl)benzamide |
| SMILES | COc1cc(-c2cn[nH]c2)ccc1C(=O)NC(C)c1c(F)cccc1F |
| InChI | InChI=1S/C19H17F2N3O2/c1-11(18-15(20)4-3-5-16(18)21)24-19(25)14-7-6-12(8-17(14)26-2)13-9-22-23-10-13/h3-11H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | FCWLESDKJOPDNI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |