C24H27N5O2 — CID 118663092
3-methyl-4-(1H-pyrazol-4-yl)-N-[[3-[[(2R)-pyrrolidin-2-yl]methylcarbamoyl]phenyl]methyl]benzamide (PubChem CID 118663092) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-methyl-4-(1H-pyrazol-4-yl)-N-[[3-[[(2R)-pyrrolidin-2-yl]methylcarbamoyl]phenyl]methyl]benzamide.
| Compound Name | 3-methyl-4-(1H-pyrazol-4-yl)-N-[[3-[[(2R)-pyrrolidin-2-yl]methylcarbamoyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 118663092 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3-methyl-4-(1H-pyrazol-4-yl)-N-[[3-[[(2R)-pyrrolidin-2-yl]methylcarbamoyl]phenyl]methyl]benzamide |
| SMILES | Cc1cc(C(=O)NCc2cccc(C(=O)NC[C@H]3CCCN3)c2)ccc1-c1cn[nH]c1 |
| InChI | InChI=1S/C24H27N5O2/c1-16-10-19(7-8-22(16)20-13-28-29-14-20)24(31)26-12-17-4-2-5-18(11-17)23(30)27-15-21-6-3-9-25-21/h2,4-5,7-8,10-11,13-14,21,25H,3,6,9,12,15H2,1H3,(H,26,31)(H,27,30)(H,28,29)/t21-/m1/s1 |
| InChIKey | UANOWIUKWGKWOC-OAQYLSRUSA-N |
| XLogP | 2.80 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |