C8H3F14NO — CID 118663163
(Z)-1,3,3,3-tetrafluoro-2-(2,2,3,3-tetrafluoropropoxy)-N,N-bis(trifluoromethyl)prop-1-en-1-amine (PubChem CID 118663163) has the molecular formula C8H3F14NO and a molecular weight of 395.09 g/mol. Its IUPAC name is (Z)-1,3,3,3-tetrafluoro-2-(2,2,3,3-tetrafluoropropoxy)-N,N-bis(trifluoromethyl)prop-1-en-1-amine.
| Compound Name | (Z)-1,3,3,3-tetrafluoro-2-(2,2,3,3-tetrafluoropropoxy)-N,N-bis(trifluoromethyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 118663163 |
| Molecular Formula | C8H3F14NO |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | (Z)-1,3,3,3-tetrafluoro-2-(2,2,3,3-tetrafluoropropoxy)-N,N-bis(trifluoromethyl)prop-1-en-1-amine |
| SMILES | F/C(=C(\OCC(F)(F)C(F)F)C(F)(F)F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H3F14NO/c9-3(23(7(17,18)19)8(20,21)22)2(6(14,15)16)24-1-5(12,13)4(10)11/h4H,1H2/b3-2+ |
| InChIKey | FFPCPYHIEPUWJU-NSCUHMNNSA-N |
| XLogP | 4.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|