C8H3F12NO2 — CID 118663194
2,2,3,3,5,5,6,6-octafluoro-4-[(Z)-1,3,3,3-tetrafluoro-2-methoxyprop-1-enyl]morpholine (PubChem CID 118663194) has the molecular formula C8H3F12NO2 and a molecular weight of 373.09 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-[(Z)-1,3,3,3-tetrafluoro-2-methoxyprop-1-enyl]morpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-[(Z)-1,3,3,3-tetrafluoro-2-methoxyprop-1-enyl]morpholine |
|---|---|
| PubChem CID | 118663194 |
| Molecular Formula | C8H3F12NO2 |
| Molecular Weight | 373.09 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-[(Z)-1,3,3,3-tetrafluoro-2-methoxyprop-1-enyl]morpholine |
| SMILES | CO/C(=C(\F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H3F12NO2/c1-22-2(4(10,11)12)3(9)21-5(13,14)7(17,18)23-8(19,20)6(21,15)16/h1H3/b3-2+ |
| InChIKey | LBWMNHIONOFDOD-NSCUHMNNSA-N |
| XLogP | 4.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.09 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|