C21H32N4O6 — CID 11866356
(1S,3R,4R,5S)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 11866356) has the molecular formula C21H32N4O6 and a molecular weight of 436.51 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11866356 |
| Molecular Formula | C21H32N4O6 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N[C@H]2C[C@@](O)(C(=O)N[C@H](CC(C)C)C(N)=O)C[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C21H32N4O6/c1-11(2)8-14(18(22)28)24-19(29)21(31)9-15(17(27)16(26)10-21)25-20(30)23-13-6-4-12(3)5-7-13/h4-7,11,14-17,26-27,31H,8-10H2,1-3H3,(H2,22,28)(H,24,29)(H2,23,25,30)/t14-,15+,16-,17-,21+/m1/s1 |
| InChIKey | NXXDPPXTACSKNZ-JUEKAOKDSA-N |
| XLogP | -0.25 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |