C20H28N4O6 — CID 11866365
(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]-N-[(3S)-2-oxopiperidin-3-yl]cyclohexane-1-carboxamide (PubChem CID 11866365) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is (1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]-N-[(3S)-2-oxopiperidin-3-yl]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]-N-[(3S)-2-oxopiperidin-3-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11866365 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]-N-[(3S)-2-oxopiperidin-3-yl]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N[C@H]2C[C@@](O)(C(=O)N[C@H]3CCCNC3=O)C[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H28N4O6/c1-11-4-6-12(7-5-11)22-19(29)24-14-9-20(30,10-15(25)16(14)26)18(28)23-13-3-2-8-21-17(13)27/h4-7,13-16,25-26,30H,2-3,8-10H2,1H3,(H,21,27)(H,23,28)(H2,22,24,29)/t13-,14-,15+,16+,20-/m0/s1 |
| InChIKey | GYAOKQVWJZFZGO-FBSOPKPWSA-N |
| XLogP | -0.87 |
| TPSA | 160.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |