C23H27NO2S2 — CID 11866382
(3S,3aS,5aS,10S,10aS,10bS)-3,5a,10-trimethyl-8-(phenylsulfanylmethyl)-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-2-one (PubChem CID 11866382) has the molecular formula C23H27NO2S2 and a molecular weight of 413.61 g/mol. Its IUPAC name is (3S,3aS,5aS,10S,10aS,10bS)-3,5a,10-trimethyl-8-(phenylsulfanylmethyl)-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-2-one.
| Compound Name | (3S,3aS,5aS,10S,10aS,10bS)-3,5a,10-trimethyl-8-(phenylsulfanylmethyl)-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-2-one |
|---|---|
| PubChem CID | 11866382 |
| Molecular Formula | C23H27NO2S2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (3S,3aS,5aS,10S,10aS,10bS)-3,5a,10-trimethyl-8-(phenylsulfanylmethyl)-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-2-one |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@H]1CC[C@@]1(C)Cc3sc(CSc4ccccc4)nc3[C@@H](C)[C@H]21 |
| InChI | InChI=1S/C23H27NO2S2/c1-13-16-9-10-23(3)11-17-20(14(2)19(23)21(16)26-22(13)25)24-18(28-17)12-27-15-7-5-4-6-8-15/h4-8,13-14,16,19,21H,9-12H2,1-3H3/t13-,14-,16-,19+,21-,23-/m0/s1 |
| InChIKey | KJMYEPALBFHMKS-DGQMRZNCSA-N |
| XLogP | 5.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |