About 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol
2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol (PubChem CID 118664076) has the molecular formula C10H12ClNO
and a molecular weight of 197.67 g/mol. Its IUPAC name is 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol.
Molecular Properties
| Compound Name | 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol |
| PubChem CID | 118664076 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol |
| SMILES | CC1(O)CCCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C10H12ClNO/c1-10(13)6-2-3-7-4-5-8(11)12-9(7)10/h4-5,13H,2-3,6H2,1H3 |
| InChIKey | YQRXULPVMPCWCT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol?
The IUPAC name of 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol (CID 118664076) is 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol.
What is the SMILES notation for 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol?
The canonical SMILES for 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol is CC1(O)CCCc2ccc(Cl)nc21.
What is the InChIKey of 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol?
The InChIKey is YQRXULPVMPCWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO/c1-10(13)6-2-3-7-4-5-8(11)12-9(7)10/h4-5,13H,2-3,6H2,1H3.
What are the key properties of 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol?
2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol has a molecular weight of 197.67 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol is sourced from PubChem (CID 118664076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).