C13H16BrF3N2OS — CID 118664091
(NE,R)-N-[1-(6-bromo-2-pyridinyl)-4,4,4-trifluorobutylidene]-2-methylpropane-2-sulfinamide (PubChem CID 118664091) has the molecular formula C13H16BrF3N2OS and a molecular weight of 385.25 g/mol. Its IUPAC name is (NE,R)-N-[1-(6-bromo-2-pyridinyl)-4,4,4-trifluorobutylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[1-(6-bromo-2-pyridinyl)-4,4,4-trifluorobutylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118664091 |
| Molecular Formula | C13H16BrF3N2OS |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (NE,R)-N-[1-(6-bromo-2-pyridinyl)-4,4,4-trifluorobutylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C(\CCC(F)(F)F)c1cccc(Br)n1 |
| InChI | InChI=1S/C13H16BrF3N2OS/c1-12(2,3)21(20)19-10(7-8-13(15,16)17)9-5-4-6-11(14)18-9/h4-6H,7-8H2,1-3H3/b19-10+/t21-/m1/s1 |
| InChIKey | ZAWFBAKFVFWSEY-IDQDRXHYSA-N |
| XLogP | 4.44 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|