About 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid
4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid (PubChem CID 118664169) has the molecular formula C12H24N2O5
and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid.
Molecular Properties
| Compound Name | 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid |
| PubChem CID | 118664169 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid |
| SMILES | CC(C)(C)NCC(=O)O.NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C6H11NO3.C6H13NO2/c7-6(5(8)9)1-3-10-4-2-6;1-6(2,3)7-4-5(8)9/h1-4,7H2,(H,8,9);7H,4H2,1-3H3,(H,8,9) |
| InChIKey | WSCCJDHMCMIAGG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid?
The IUPAC name of 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid (CID 118664169) is 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid.
What is the SMILES notation for 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid?
The canonical SMILES for 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid is CC(C)(C)NCC(=O)O.NC1(C(=O)O)CCOCC1.
What is the InChIKey of 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid?
The InChIKey is WSCCJDHMCMIAGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3.C6H13NO2/c7-6(5(8)9)1-3-10-4-2-6;1-6(2,3)7-4-5(8)9/h1-4,7H2,(H,8,9);7H,4H2,1-3H3,(H,8,9).
What are the key properties of 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid?
4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid has a molecular weight of 276.33 g/mol, XLogP of 0.04, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxane-4-carboxylic acid;2-(tert-butylamino)acetic acid is sourced from PubChem (CID 118664169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).