About 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole
6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole (PubChem CID 118664223) has the molecular formula C14H12BrN3
and a molecular weight of 302.18 g/mol. Its IUPAC name is 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole.
Molecular Properties
| Compound Name | 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole |
| PubChem CID | 118664223 |
| Molecular Formula | C14H12BrN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole |
| SMILES | Cc1ccc(-n2ncc3ccc(Br)cc32)nc1C |
| InChI | InChI=1S/C14H12BrN3/c1-9-3-6-14(17-10(9)2)18-13-7-12(15)5-4-11(13)8-16-18/h3-8H,1-2H3 |
| InChIKey | KSMYHCQTNLONRW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole?
The IUPAC name of 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole (CID 118664223) is 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole.
What is the SMILES notation for 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole?
The canonical SMILES for 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole is Cc1ccc(-n2ncc3ccc(Br)cc32)nc1C.
What is the InChIKey of 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole?
The InChIKey is KSMYHCQTNLONRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrN3/c1-9-3-6-14(17-10(9)2)18-13-7-12(15)5-4-11(13)8-16-18/h3-8H,1-2H3.
What are the key properties of 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole?
6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole has a molecular weight of 302.18 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-(5,6-dimethyl-2-pyridinyl)indazole is sourced from PubChem (CID 118664223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).