C21H14F3N7O — CID 118664326
6-amino-N-(cyanomethyl)-4-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]pyridine-2-carboxamide (PubChem CID 118664326) has the molecular formula C21H14F3N7O and a molecular weight of 437.39 g/mol. Its IUPAC name is 6-amino-N-(cyanomethyl)-4-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]pyridine-2-carboxamide.
| Compound Name | 6-amino-N-(cyanomethyl)-4-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118664326 |
| Molecular Formula | C21H14F3N7O |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 6-amino-N-(cyanomethyl)-4-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]pyridine-2-carboxamide |
| SMILES | N#CCNC(=O)c1cc(-c2ccc3cnn(-c4cccc(C(F)(F)F)n4)c3c2)cc(N)n1 |
| InChI | InChI=1S/C21H14F3N7O/c22-21(23,24)17-2-1-3-19(30-17)31-16-9-12(4-5-13(16)11-28-31)14-8-15(29-18(26)10-14)20(32)27-7-6-25/h1-5,8-11H,7H2,(H2,26,29)(H,27,32) |
| InChIKey | RLYSZYPURDYGKE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|