About 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one
5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one (PubChem CID 118664336) has the molecular formula C10H15ClO4
and a molecular weight of 234.68 g/mol. Its IUPAC name is 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one |
| PubChem CID | 118664336 |
| Molecular Formula | C10H15ClO4 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one |
| SMILES | COC1=CC(=O)CC(C)(Cl)C1(OC)OC |
| InChI | InChI=1S/C10H15ClO4/c1-9(11)6-7(12)5-8(13-2)10(9,14-3)15-4/h5H,6H2,1-4H3 |
| InChIKey | HIHJHNHVSDFBCW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one?
The IUPAC name of 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one (CID 118664336) is 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one.
What is the SMILES notation for 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one?
The canonical SMILES for 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one is COC1=CC(=O)CC(C)(Cl)C1(OC)OC.
What is the InChIKey of 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one?
The InChIKey is HIHJHNHVSDFBCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClO4/c1-9(11)6-7(12)5-8(13-2)10(9,14-3)15-4/h5H,6H2,1-4H3.
What are the key properties of 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one?
5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one has a molecular weight of 234.68 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,4,4-trimethoxy-5-methylcyclohex-2-en-1-one is sourced from PubChem (CID 118664336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).