C10H14O5 — CID 118664501
2,3,4,4-tetramethoxycyclohexa-2,5-dien-1-one (PubChem CID 118664501) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2,3,4,4-tetramethoxycyclohexa-2,5-dien-1-one.
| Compound Name | 2,3,4,4-tetramethoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 118664501 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2,3,4,4-tetramethoxycyclohexa-2,5-dien-1-one |
| SMILES | COC1=C(OC)C(OC)(OC)C=CC1=O |
| InChI | InChI=1S/C10H14O5/c1-12-8-7(11)5-6-10(14-3,15-4)9(8)13-2/h5-6H,1-4H3 |
| InChIKey | ZLCVNPJFRBPRIP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|