C16H26O5 — CID 118664593
2,3,4,4-tetramethoxy-5-methyl-6-(3-methylbut-2-enyl)cyclohex-2-en-1-one (PubChem CID 118664593) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,3,4,4-tetramethoxy-5-methyl-6-(3-methylbut-2-enyl)cyclohex-2-en-1-one.
| Compound Name | 2,3,4,4-tetramethoxy-5-methyl-6-(3-methylbut-2-enyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118664593 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2,3,4,4-tetramethoxy-5-methyl-6-(3-methylbut-2-enyl)cyclohex-2-en-1-one |
| SMILES | COC1=C(OC)C(OC)(OC)C(C)C(CC=C(C)C)C1=O |
| InChI | InChI=1S/C16H26O5/c1-10(2)8-9-12-11(3)16(20-6,21-7)15(19-5)14(18-4)13(12)17/h8,11-12H,9H2,1-7H3 |
| InChIKey | KQEMIFUGHYQKEO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|