C19H12ClF7N4O2 — CID 118665754
2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]pyridine-3-carboxylic acid (PubChem CID 118665754) has the molecular formula C19H12ClF7N4O2 and a molecular weight of 496.77 g/mol. Its IUPAC name is 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]pyridine-3-carboxylic acid.
| Compound Name | 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118665754 |
| Molecular Formula | C19H12ClF7N4O2 |
| Molecular Weight | 496.77 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]pyridine-3-carboxylic acid |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1-n1cc(-c2cnc(Cl)c(C(=O)O)c2)nn1 |
| InChI | InChI=1S/C19H12ClF7N4O2/c1-8-3-11(17(21,18(22,23)24)19(25,26)27)4-9(2)14(8)31-7-13(29-30-31)10-5-12(16(32)33)15(20)28-6-10/h3-7H,1-2H3,(H,32,33) |
| InChIKey | QYOYIVUBMYZHII-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.77 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|