C20H15F7N4O2 — CID 118665761
5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]-2-methylpyridine-3-carboxylic acid (PubChem CID 118665761) has the molecular formula C20H15F7N4O2 and a molecular weight of 476.35 g/mol. Its IUPAC name is 5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]-2-methylpyridine-3-carboxylic acid.
| Compound Name | 5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]-2-methylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118665761 |
| Molecular Formula | C20H15F7N4O2 |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]-2-methylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1-n1cc(-c2cnc(C)c(C(=O)O)c2)nn1 |
| InChI | InChI=1S/C20H15F7N4O2/c1-9-4-13(18(21,19(22,23)24)20(25,26)27)5-10(2)16(9)31-8-15(29-30-31)12-6-14(17(32)33)11(3)28-7-12/h4-8H,1-3H3,(H,32,33) |
| InChIKey | ZGXSXCCFMPXXCJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |