C18H9Cl2F7N4O2 — CID 118665776
5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methylpyridine-3-carboxylic acid (PubChem CID 118665776) has the molecular formula C18H9Cl2F7N4O2 and a molecular weight of 517.19 g/mol. Its IUPAC name is 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methylpyridine-3-carboxylic acid.
| Compound Name | 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118665776 |
| Molecular Formula | C18H9Cl2F7N4O2 |
| Molecular Weight | 517.19 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methylpyridine-3-carboxylic acid |
| SMILES | Cc1ncc(-c2cn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)nn2)cc1C(=O)O |
| InChI | InChI=1S/C18H9Cl2F7N4O2/c1-7-10(15(32)33)2-8(5-28-7)13-6-31(30-29-13)14-11(19)3-9(4-12(14)20)16(21,17(22,23)24)18(25,26)27/h2-6H,1H3,(H,32,33) |
| InChIKey | MTHNQCBOQWJUPO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.19 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |