C11H14F3NO2 — CID 118665916
1-(7,7,7-trifluoroheptyl)pyrrole-2,5-dione (PubChem CID 118665916) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 1-(7,7,7-trifluoroheptyl)pyrrole-2,5-dione.
| Compound Name | 1-(7,7,7-trifluoroheptyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 118665916 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(7,7,7-trifluoroheptyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCCCC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2/c12-11(13,14)7-3-1-2-4-8-15-9(16)5-6-10(15)17/h5-6H,1-4,7-8H2 |
| InChIKey | CGMVCJMMNYBOIR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|