C20H31F3N2O4 — CID 118665919
tert-butyl (2S)-2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoate (PubChem CID 118665919) has the molecular formula C20H31F3N2O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 118665919 |
| Molecular Formula | C20H31F3N2O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | tert-butyl (2S)-2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(CCCCCN1C(=O)C=CC1=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31F3N2O4/c1-13(2)17(18(28)29-19(3,4)5)24-14(20(21,22)23)9-7-6-8-12-25-15(26)10-11-16(25)27/h10-11,13-14,17,24H,6-9,12H2,1-5H3/t14?,17-/m0/s1 |
| InChIKey | JDLQOFHTVZPKMT-JRZJBTRGSA-N |
| XLogP | 3.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|