C24H34N2O2S2 — CID 11866628
(2S)-2-[(4S,4aS,5S,6S,8aS)-5-hydroxy-4,8a-dimethyl-2-thiophen-3-yl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N,N-diethylpropanamide (PubChem CID 11866628) has the molecular formula C24H34N2O2S2 and a molecular weight of 446.68 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,6S,8aS)-5-hydroxy-4,8a-dimethyl-2-thiophen-3-yl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N,N-diethylpropanamide.
| Compound Name | (2S)-2-[(4S,4aS,5S,6S,8aS)-5-hydroxy-4,8a-dimethyl-2-thiophen-3-yl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 11866628 |
| Molecular Formula | C24H34N2O2S2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,6S,8aS)-5-hydroxy-4,8a-dimethyl-2-thiophen-3-yl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)[C@@H](C)[C@@H]1CC[C@@]2(C)Cc3sc(-c4ccsc4)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C24H34N2O2S2/c1-6-26(7-2)23(28)14(3)17-8-10-24(5)12-18-20(15(4)19(24)21(17)27)25-22(30-18)16-9-11-29-13-16/h9,11,13-15,17,19,21,27H,6-8,10,12H2,1-5H3/t14-,15-,17-,19+,21-,24-/m0/s1 |
| InChIKey | ZQCZCDVKIPCHEE-SVZXJXMESA-N |
| XLogP | 5.43 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |