C24H32N2O3S2 — CID 11866633
(2S)-2-[(4S,4aS,5S,6R,8aS)-5-hydroxy-4,8a-dimethyl-2-thiophen-3-yl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one (PubChem CID 11866633) has the molecular formula C24H32N2O3S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,6R,8aS)-5-hydroxy-4,8a-dimethyl-2-thiophen-3-yl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | (2S)-2-[(4S,4aS,5S,6R,8aS)-5-hydroxy-4,8a-dimethyl-2-thiophen-3-yl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 11866633 |
| Molecular Formula | C24H32N2O3S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,6R,8aS)-5-hydroxy-4,8a-dimethyl-2-thiophen-3-yl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one |
| SMILES | C[C@H](C(=O)N1CCOCC1)[C@H]1CC[C@@]2(C)Cc3sc(-c4ccsc4)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C24H32N2O3S2/c1-14(23(28)26-7-9-29-10-8-26)17-4-6-24(3)12-18-20(15(2)19(24)21(17)27)25-22(31-18)16-5-11-30-13-16/h5,11,13-15,17,19,21,27H,4,6-10,12H2,1-3H3/t14-,15-,17+,19+,21-,24-/m0/s1 |
| InChIKey | BJOXRXGBJVAFPV-IXMAWCDFSA-N |
| XLogP | 4.42 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |