C32H40N4O — CID 118666925
[9-[3-(diethylamino)propyl]carbazol-2-yl]-[4-(2-phenylethyl)piperazin-1-yl]methanone (PubChem CID 118666925) has the molecular formula C32H40N4O and a molecular weight of 496.70 g/mol. Its IUPAC name is [9-[3-(diethylamino)propyl]carbazol-2-yl]-[4-(2-phenylethyl)piperazin-1-yl]methanone.
| Compound Name | [9-[3-(diethylamino)propyl]carbazol-2-yl]-[4-(2-phenylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 118666925 |
| Molecular Formula | C32H40N4O |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | [9-[3-(diethylamino)propyl]carbazol-2-yl]-[4-(2-phenylethyl)piperazin-1-yl]methanone |
| SMILES | CCN(CC)CCCn1c2ccccc2c2ccc(C(=O)N3CCN(CCc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C32H40N4O/c1-3-33(4-2)18-10-19-36-30-14-9-8-13-28(30)29-16-15-27(25-31(29)36)32(37)35-23-21-34(22-24-35)20-17-26-11-6-5-7-12-26/h5-9,11-16,25H,3-4,10,17-24H2,1-2H3 |
| InChIKey | VNASPLYUYUXTFS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |