C22H20F3NO2 — CID 118667246
N-[[(4S)-2,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]-[4-(trifluoromethoxy)phenyl]methyl]aniline (PubChem CID 118667246) has the molecular formula C22H20F3NO2 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[[(4S)-2,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]-[4-(trifluoromethoxy)phenyl]methyl]aniline.
| Compound Name | N-[[(4S)-2,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]-[4-(trifluoromethoxy)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 118667246 |
| Molecular Formula | C22H20F3NO2 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[[(4S)-2,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]-[4-(trifluoromethoxy)phenyl]methyl]aniline |
| SMILES | CC1=C(C)C2(C(Nc3ccccc3)c3ccc(OC(F)(F)F)cc3)C=C[C@@H]1O2 |
| InChI | InChI=1S/C22H20F3NO2/c1-14-15(2)21(13-12-19(14)28-21)20(26-17-6-4-3-5-7-17)16-8-10-18(11-9-16)27-22(23,24)25/h3-13,19-20,26H,1-2H3/t19-,20?,21?/m0/s1 |
| InChIKey | CUVLWTDIFSPQTK-MWXLCCTBSA-N |
| XLogP | 5.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|