C9H13F2NO — CID 118667305
(NE)-N-[(4E,6E)-4,6-difluoro-2-methylocta-4,6-dien-3-ylidene]hydroxylamine (PubChem CID 118667305) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is (NE)-N-[(4E,6E)-4,6-difluoro-2-methylocta-4,6-dien-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4E,6E)-4,6-difluoro-2-methylocta-4,6-dien-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 118667305 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (NE)-N-[(4E,6E)-4,6-difluoro-2-methylocta-4,6-dien-3-ylidene]hydroxylamine |
| SMILES | C/C=C(F)\C=C(F)/C(=N/O)C(C)C |
| InChI | InChI=1S/C9H13F2NO/c1-4-7(10)5-8(11)9(12-13)6(2)3/h4-6,13H,1-3H3/b7-4+,8-5+,12-9+ |
| InChIKey | IOKLLOIZPRKFGG-ITLIKTLWSA-N |
| XLogP | 3.20 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|