C15H24F3N3O — CID 118667401
2-(8,8,8-trifluorooctyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 118667401) has the molecular formula C15H24F3N3O and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-(8,8,8-trifluorooctyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-(8,8,8-trifluorooctyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 118667401 |
| Molecular Formula | C15H24F3N3O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-(8,8,8-trifluorooctyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | O=C1NC(CCCCCCCC(F)(F)F)=NC12CCNCC2 |
| InChI | InChI=1S/C15H24F3N3O/c16-15(17,18)7-5-3-1-2-4-6-12-20-13(22)14(21-12)8-10-19-11-9-14/h19H,1-11H2,(H,20,21,22) |
| InChIKey | OSXZFDYAOQKDJB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|