C32H21F3N6O2 — CID 118667679
4,5,19-trimethyl-10,11-diphenoxy-18-(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2,4,6,8(13),9,11,14,16(21),17,19-undecaene (PubChem CID 118667679) has the molecular formula C32H21F3N6O2 and a molecular weight of 578.55 g/mol. Its IUPAC name is 4,5,19-trimethyl-10,11-diphenoxy-18-(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2,4,6,8(13),9,11,14,16(21),17,19-undecaene.
| Compound Name | 4,5,19-trimethyl-10,11-diphenoxy-18-(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2,4,6,8(13),9,11,14,16(21),17,19-undecaene |
|---|---|
| PubChem CID | 118667679 |
| Molecular Formula | C32H21F3N6O2 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 4,5,19-trimethyl-10,11-diphenoxy-18-(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2,4,6,8(13),9,11,14,16(21),17,19-undecaene |
| SMILES | Cc1cc2nc3c4nc(C)c(C)nc4c4nc(Oc5ccccc5)c(Oc5ccccc5)nc4c3nc2cc1C(F)(F)F |
| InChI | InChI=1S/C32H21F3N6O2/c1-16-14-22-23(15-21(16)32(33,34)35)39-27-26(38-22)24-25(37-18(3)17(2)36-24)28-29(27)41-31(43-20-12-8-5-9-13-20)30(40-28)42-19-10-6-4-7-11-19/h4-15H,1-3H3 |
| InChIKey | LTWWOCJHIKSCQC-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|