C18H17FO8 — CID 118667685
5-[4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-fluorocyclohexa-2,5-dien-1-ylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 118667685) has the molecular formula C18H17FO8 and a molecular weight of 380.32 g/mol. Its IUPAC name is 5-[4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-fluorocyclohexa-2,5-dien-1-ylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-fluorocyclohexa-2,5-dien-1-ylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 118667685 |
| Molecular Formula | C18H17FO8 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 5-[4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-fluorocyclohexa-2,5-dien-1-ylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C2C=CC(C3C(=O)OC(C)(C)OC3=O)C=C2F)C(=O)O1 |
| InChI | InChI=1S/C18H17FO8/c1-17(2)24-13(20)11(14(21)25-17)8-5-6-9(10(19)7-8)12-15(22)26-18(3,4)27-16(12)23/h5-8,11H,1-4H3 |
| InChIKey | XGPLMTQNGRDDRH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|