About 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione
1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione (PubChem CID 118667729) has the molecular formula C17H29NO3
and a molecular weight of 295.42 g/mol. Its IUPAC name is 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione |
| PubChem CID | 118667729 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)CC(O)C1CCC(CN2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C17H29NO3/c1-17(2,3)10-14(19)13-6-4-12(5-7-13)11-18-15(20)8-9-16(18)21/h12-14,19H,4-11H2,1-3H3 |
| InChIKey | TWABKZYJTMKKEL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione?
The IUPAC name of 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione (CID 118667729) is 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione.
What is the SMILES notation for 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione?
The canonical SMILES for 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione is CC(C)(C)CC(O)C1CCC(CN2C(=O)CCC2=O)CC1.
What is the InChIKey of 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione?
The InChIKey is TWABKZYJTMKKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO3/c1-17(2,3)10-14(19)13-6-4-12(5-7-13)11-18-15(20)8-9-16(18)21/h12-14,19H,4-11H2,1-3H3.
What are the key properties of 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione?
1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione has a molecular weight of 295.42 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(1-hydroxy-3,3-dimethylbutyl)cyclohexyl]methyl]pyrrolidine-2,5-dione is sourced from PubChem (CID 118667729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).