C12H14N2O4 — CID 118667816
methyl (E)-4-[[2-(2-oxo-1-pyridinyl)acetyl]amino]but-2-enoate (PubChem CID 118667816) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl (E)-4-[[2-(2-oxo-1-pyridinyl)acetyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[2-(2-oxo-1-pyridinyl)acetyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 118667816 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | methyl (E)-4-[[2-(2-oxo-1-pyridinyl)acetyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C12H14N2O4/c1-18-12(17)6-4-7-13-10(15)9-14-8-3-2-5-11(14)16/h2-6,8H,7,9H2,1H3,(H,13,15)/b6-4+ |
| InChIKey | NEUZNCSDNIJUJK-GQCTYLIASA-N |
| XLogP | -0.31 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|