About 1,4,7-trimethyl-3a,7a-dihydroindazole
1,4,7-trimethyl-3a,7a-dihydroindazole (PubChem CID 118668470) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,4,7-trimethyl-3a,7a-dihydroindazole.
Molecular Properties
| Compound Name | 1,4,7-trimethyl-3a,7a-dihydroindazole |
| PubChem CID | 118668470 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,4,7-trimethyl-3a,7a-dihydroindazole |
| SMILES | CC1=CC=C(C)C2C1C=NN2C |
| InChI | InChI=1S/C10H14N2/c1-7-4-5-8(2)10-9(7)6-11-12(10)3/h4-6,9-10H,1-3H3 |
| InChIKey | QOJAUYRYRPBVHJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4,7-trimethyl-3a,7a-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,7-trimethyl-3a,7a-dihydroindazole?
The IUPAC name of 1,4,7-trimethyl-3a,7a-dihydroindazole (CID 118668470) is 1,4,7-trimethyl-3a,7a-dihydroindazole.
What is the SMILES notation for 1,4,7-trimethyl-3a,7a-dihydroindazole?
The canonical SMILES for 1,4,7-trimethyl-3a,7a-dihydroindazole is CC1=CC=C(C)C2C1C=NN2C.
What is the InChIKey of 1,4,7-trimethyl-3a,7a-dihydroindazole?
The InChIKey is QOJAUYRYRPBVHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-7-4-5-8(2)10-9(7)6-11-12(10)3/h4-6,9-10H,1-3H3.
What are the key properties of 1,4,7-trimethyl-3a,7a-dihydroindazole?
1,4,7-trimethyl-3a,7a-dihydroindazole has a molecular weight of 162.24 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,7-trimethyl-3a,7a-dihydroindazole is sourced from PubChem (CID 118668470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).